C12H16N4S — CID 55091235
4-(3,5-dimethylpiperazin-1-yl)thieno[3,2-d]pyrimidine (PubChem CID 55091235) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperazin-1-yl)thieno[3,2-d]pyrimidine.
| Compound Name | 4-(3,5-dimethylpiperazin-1-yl)thieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 55091235 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-(3,5-dimethylpiperazin-1-yl)thieno[3,2-d]pyrimidine |
| SMILES | CC1CN(c2ncnc3ccsc23)CC(C)N1 |
| InChI | InChI=1S/C12H16N4S/c1-8-5-16(6-9(2)15-8)12-11-10(3-4-17-11)13-7-14-12/h3-4,7-9,15H,5-6H2,1-2H3 |
| InChIKey | GOEIWHKIUVWFHE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |