C12H14N4OS — CID 122568150
(4aS,7aS)-6-thieno[3,2-d]pyrimidin-4-yl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine (PubChem CID 122568150) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is (4aS,7aS)-6-thieno[3,2-d]pyrimidin-4-yl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aS)-6-thieno[3,2-d]pyrimidin-4-yl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 122568150 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (4aS,7aS)-6-thieno[3,2-d]pyrimidin-4-yl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
| SMILES | c1nc(N2C[C@@H]3NCCO[C@H]3C2)c2sccc2n1 |
| InChI | InChI=1S/C12H14N4OS/c1-4-18-11-8(1)14-7-15-12(11)16-5-9-10(6-16)17-3-2-13-9/h1,4,7,9-10,13H,2-3,5-6H2/t9-,10-/m0/s1 |
| InChIKey | DYKHZZOXSLRDJT-UWVGGRQHSA-N |
| XLogP | 0.87 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |