C14H20N4S — CID 64979282
4-(2,5-diethylpiperazin-1-yl)thieno[3,2-d]pyrimidine (PubChem CID 64979282) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is 4-(2,5-diethylpiperazin-1-yl)thieno[3,2-d]pyrimidine.
| Compound Name | 4-(2,5-diethylpiperazin-1-yl)thieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 64979282 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-(2,5-diethylpiperazin-1-yl)thieno[3,2-d]pyrimidine |
| SMILES | CCC1CN(c2ncnc3ccsc23)C(CC)CN1 |
| InChI | InChI=1S/C14H20N4S/c1-3-10-8-18(11(4-2)7-15-10)14-13-12(5-6-19-13)16-9-17-14/h5-6,9-11,15H,3-4,7-8H2,1-2H3 |
| InChIKey | GOFLHXFWNVAEJS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |