About 4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine
4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine (PubChem CID 106535311) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine |
| PubChem CID | 106535311 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine |
| SMILES | CCC1CN(c2nccc3occc23)C(CC)CN1 |
| InChI | InChI=1S/C15H21N3O/c1-3-11-10-18(12(4-2)9-17-11)15-13-6-8-19-14(13)5-7-16-15/h5-8,11-12,17H,3-4,9-10H2,1-2H3 |
| InChIKey | XUAHKTAIGDYTFG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine?
The IUPAC name of 4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine (CID 106535311) is 4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine.
What is the SMILES notation for 4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine?
The canonical SMILES for 4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine is CCC1CN(c2nccc3occc23)C(CC)CN1.
What is the InChIKey of 4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine?
The InChIKey is XUAHKTAIGDYTFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O/c1-3-11-10-18(12(4-2)9-17-11)15-13-6-8-19-14(13)5-7-16-15/h5-8,11-12,17H,3-4,9-10H2,1-2H3.
What are the key properties of 4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine?
4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine has a molecular weight of 259.35 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-diethylpiperazin-1-yl)furo[3,2-c]pyridine is sourced from PubChem (CID 106535311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).