C16H26N4O — CID 64979161
4-(2,5-diethylpiperazin-1-yl)-N-ethylpyridine-2-carboxamide (PubChem CID 64979161) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-(2,5-diethylpiperazin-1-yl)-N-ethylpyridine-2-carboxamide.
| Compound Name | 4-(2,5-diethylpiperazin-1-yl)-N-ethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 64979161 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 4-(2,5-diethylpiperazin-1-yl)-N-ethylpyridine-2-carboxamide |
| SMILES | CCNC(=O)c1cc(N2CC(CC)NCC2CC)ccn1 |
| InChI | InChI=1S/C16H26N4O/c1-4-12-11-20(13(5-2)10-19-12)14-7-8-18-15(9-14)16(21)17-6-3/h7-9,12-13,19H,4-6,10-11H2,1-3H3,(H,17,21) |
| InChIKey | UORJPGLZNXGWNL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |