C13H17N3O3S — CID 82901293
4-[2-(ethylcarbamoyl)-4-pyridinyl]thiomorpholine-3-carboxylic acid (PubChem CID 82901293) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 4-[2-(ethylcarbamoyl)-4-pyridinyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[2-(ethylcarbamoyl)-4-pyridinyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82901293 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 4-[2-(ethylcarbamoyl)-4-pyridinyl]thiomorpholine-3-carboxylic acid |
| SMILES | CCNC(=O)c1cc(N2CCSCC2C(=O)O)ccn1 |
| InChI | InChI=1S/C13H17N3O3S/c1-2-14-12(17)10-7-9(3-4-15-10)16-5-6-20-8-11(16)13(18)19/h3-4,7,11H,2,5-6,8H2,1H3,(H,14,17)(H,18,19) |
| InChIKey | MRUUYMCKMBWKLR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |