C13H16N2O2 — CID 123836897
4-[2-(methoxymethyl)pyrrolidin-1-yl]furo[3,2-c]pyridine (PubChem CID 123836897) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 4-[2-(methoxymethyl)pyrrolidin-1-yl]furo[3,2-c]pyridine.
| Compound Name | 4-[2-(methoxymethyl)pyrrolidin-1-yl]furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 123836897 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 4-[2-(methoxymethyl)pyrrolidin-1-yl]furo[3,2-c]pyridine |
| SMILES | COCC1CCCN1c1nccc2occc12 |
| InChI | InChI=1S/C13H16N2O2/c1-16-9-10-3-2-7-15(10)13-11-5-8-17-12(11)4-6-14-13/h4-6,8,10H,2-3,7,9H2,1H3 |
| InChIKey | RZOFYMNWJBELQS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |