C15H18N2O3 — CID 99636617
ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate (PubChem CID 99636617) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 99636617 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(c2nccc3occc23)C1 |
| InChI | InChI=1S/C15H18N2O3/c1-2-19-15(18)11-4-3-8-17(10-11)14-12-6-9-20-13(12)5-7-16-14/h5-7,9,11H,2-4,8,10H2,1H3/t11-/m0/s1 |
| InChIKey | QAOXBZJHIYVELW-NSHDSACASA-N |
| XLogP | 2.61 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |