ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate

C15H18N2O3 — CID 99636617

IUPACethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate
SMILESCCOC(=O)[C@H]1CCCN(c2nccc3occc23)C1
InChIInChI=1S/C15H18N2O3/c1-2-19-15(18)11-4-3-8-17(10-11)14-12-6-9-20-13(12)5-7-16-14/h5-7,9,11H,2-4,8,10H2,1H3/t11-/m0/s1
InChIKeyQAOXBZJHIYVELW-NSHDSACASA-N
MW274.32 g/mol
LogP2.61
Rot. Bonds3

About ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate

ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate (PubChem CID 99636617) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate.

Molecular Properties

Compound Nameethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate
PubChem CID99636617
Molecular FormulaC15H18N2O3
Molecular Weight274.32 g/mol
Exact Mass274.13
IUPAC Nameethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate
SMILESCCOC(=O)[C@H]1CCCN(c2nccc3occc23)C1
InChIInChI=1S/C15H18N2O3/c1-2-19-15(18)11-4-3-8-17(10-11)14-12-6-9-20-13(12)5-7-16-14/h5-7,9,11H,2-4,8,10H2,1H3/t11-/m0/s1
InChIKeyQAOXBZJHIYVELW-NSHDSACASA-N
XLogP2.61
TPSA55.57 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.32
LogP ≤ 52.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate?
The IUPAC name of ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate (CID 99636617) is ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate.
What is the SMILES notation for ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate?
The canonical SMILES for ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate is CCOC(=O)[C@H]1CCCN(c2nccc3occc23)C1.
What is the InChIKey of ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate?
The InChIKey is QAOXBZJHIYVELW-NSHDSACASA-N. The full InChI is InChI=1S/C15H18N2O3/c1-2-19-15(18)11-4-3-8-17(10-11)14-12-6-9-20-13(12)5-7-16-14/h5-7,9,11H,2-4,8,10H2,1H3/t11-/m0/s1.
What are the key properties of ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate?
ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate has a molecular weight of 274.32 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S)-1-furo[3,2-c]pyridin-4-ylpiperidine-3-carboxylate is sourced from PubChem (CID 99636617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).