C17H19N3O3 — CID 124514606
ethyl (3R)-1-(6-formylquinazolin-4-yl)piperidine-3-carboxylate (PubChem CID 124514606) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is ethyl (3R)-1-(6-formylquinazolin-4-yl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(6-formylquinazolin-4-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 124514606 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | ethyl (3R)-1-(6-formylquinazolin-4-yl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(c2ncnc3ccc(C=O)cc23)C1 |
| InChI | InChI=1S/C17H19N3O3/c1-2-23-17(22)13-4-3-7-20(9-13)16-14-8-12(10-21)5-6-15(14)18-11-19-16/h5-6,8,10-11,13H,2-4,7,9H2,1H3/t13-/m1/s1 |
| InChIKey | RYFOGQACKLNAMA-CYBMUJFWSA-N |
| XLogP | 2.22 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|