C12H17N5O2S2 — CID 52874103
4-[(3S)-3-[(sulfamoylamino)methyl]piperidin-1-yl]thieno[3,2-d]pyrimidine (PubChem CID 52874103) has the molecular formula C12H17N5O2S2 and a molecular weight of 327.44 g/mol. Its IUPAC name is 4-[(3S)-3-[(sulfamoylamino)methyl]piperidin-1-yl]thieno[3,2-d]pyrimidine.
| Compound Name | 4-[(3S)-3-[(sulfamoylamino)methyl]piperidin-1-yl]thieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 52874103 |
| Molecular Formula | C12H17N5O2S2 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-[(3S)-3-[(sulfamoylamino)methyl]piperidin-1-yl]thieno[3,2-d]pyrimidine |
| SMILES | NS(=O)(=O)NC[C@H]1CCCN(c2ncnc3ccsc23)C1 |
| InChI | InChI=1S/C12H17N5O2S2/c13-21(18,19)16-6-9-2-1-4-17(7-9)12-11-10(3-5-20-11)14-8-15-12/h3,5,8-9,16H,1-2,4,6-7H2,(H2,13,18,19)/t9-/m1/s1 |
| InChIKey | GCDVWSXMDBHTFJ-SECBINFHSA-N |
| XLogP | 0.70 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |