C13H16N4OS — CID 143478647
N-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)methyl]formamide (PubChem CID 143478647) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is N-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)methyl]formamide.
| Compound Name | N-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)methyl]formamide |
|---|---|
| PubChem CID | 143478647 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)methyl]formamide |
| SMILES | O=CNCC1CCN(c2ncnc3ccsc23)CC1 |
| InChI | InChI=1S/C13H16N4OS/c18-9-14-7-10-1-4-17(5-2-10)13-12-11(3-6-19-12)15-8-16-13/h3,6,8-10H,1-2,4-5,7H2,(H,14,18) |
| InChIKey | ZQZAEDIVHFVMJD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|