C16H22N4OS — CID 36790347
N-butyl-1-thieno[3,2-d]pyrimidin-4-ylpiperidine-4-carboxamide (PubChem CID 36790347) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is N-butyl-1-thieno[3,2-d]pyrimidin-4-ylpiperidine-4-carboxamide.
| Compound Name | N-butyl-1-thieno[3,2-d]pyrimidin-4-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 36790347 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-butyl-1-thieno[3,2-d]pyrimidin-4-ylpiperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(c2ncnc3ccsc23)CC1 |
| InChI | InChI=1S/C16H22N4OS/c1-2-3-7-17-16(21)12-4-8-20(9-5-12)15-14-13(6-10-22-14)18-11-19-15/h6,10-12H,2-5,7-9H2,1H3,(H,17,21) |
| InChIKey | LGTYBLZZDPBJBF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|