C21H30N4O3S — CID 171709970
N-[(3R,4S)-3-ethyl-1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl]cyclohexanecarboxamide;formic acid (PubChem CID 171709970) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-[(3R,4S)-3-ethyl-1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl]cyclohexanecarboxamide;formic acid.
| Compound Name | N-[(3R,4S)-3-ethyl-1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl]cyclohexanecarboxamide;formic acid |
|---|---|
| PubChem CID | 171709970 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-[(3R,4S)-3-ethyl-1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl]cyclohexanecarboxamide;formic acid |
| SMILES | CC[C@@H]1CN(c2ncnc3ccsc23)CC[C@@H]1NC(=O)C1CCCCC1.O=CO |
| InChI | InChI=1S/C20H28N4OS.CH2O2/c1-2-14-12-24(19-18-17(9-11-26-18)21-13-22-19)10-8-16(14)23-20(25)15-6-4-3-5-7-15;2-1-3/h9,11,13-16H,2-8,10,12H2,1H3,(H,23,25);1H,(H,2,3)/t14-,16+;/m1./s1 |
| InChIKey | SUEYXKHHALSIIX-XMZRARIVSA-N |
| XLogP | 3.69 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|