About [6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine
[6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine (PubChem CID 102938684) has the molecular formula C9H15N3OS
and a molecular weight of 213.31 g/mol. Its IUPAC name is [6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine.
Molecular Properties
| Compound Name | [6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine |
| PubChem CID | 102938684 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | [6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine |
| SMILES | CC1CN(c2nccs2)CC(CN)O1 |
| InChI | InChI=1S/C9H15N3OS/c1-7-5-12(6-8(4-10)13-7)9-11-2-3-14-9/h2-3,7-8H,4-6,10H2,1H3 |
| InChIKey | YMSDYGUWSILNOP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine?
The IUPAC name of [6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine (CID 102938684) is [6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine.
What is the SMILES notation for [6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine?
The canonical SMILES for [6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine is CC1CN(c2nccs2)CC(CN)O1.
What is the InChIKey of [6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine?
The InChIKey is YMSDYGUWSILNOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3OS/c1-7-5-12(6-8(4-10)13-7)9-11-2-3-14-9/h2-3,7-8H,4-6,10H2,1H3.
What are the key properties of [6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine?
[6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine has a molecular weight of 213.31 g/mol, XLogP of 0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methyl-4-(1,3-thiazol-2-yl)morpholin-2-yl]methanamine is sourced from PubChem (CID 102938684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).