C11H15BrClN3O — CID 103584271
[4-(5-bromo-3-chloro-2-pyridinyl)-6-methylmorpholin-2-yl]methanamine (PubChem CID 103584271) has the molecular formula C11H15BrClN3O and a molecular weight of 320.62 g/mol. Its IUPAC name is [4-(5-bromo-3-chloro-2-pyridinyl)-6-methylmorpholin-2-yl]methanamine.
| Compound Name | [4-(5-bromo-3-chloro-2-pyridinyl)-6-methylmorpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 103584271 |
| Molecular Formula | C11H15BrClN3O |
| Molecular Weight | 320.62 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | [4-(5-bromo-3-chloro-2-pyridinyl)-6-methylmorpholin-2-yl]methanamine |
| SMILES | CC1CN(c2ncc(Br)cc2Cl)CC(CN)O1 |
| InChI | InChI=1S/C11H15BrClN3O/c1-7-5-16(6-9(3-14)17-7)11-10(13)2-8(12)4-15-11/h2,4,7,9H,3,5-6,14H2,1H3 |
| InChIKey | RWBQVWLWVHTVAN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.62 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |