C9H11BrClN3 — CID 103584239
[1-(5-bromo-3-chloro-2-pyridinyl)azetidin-3-yl]methanamine (PubChem CID 103584239) has the molecular formula C9H11BrClN3 and a molecular weight of 276.56 g/mol. Its IUPAC name is [1-(5-bromo-3-chloro-2-pyridinyl)azetidin-3-yl]methanamine.
| Compound Name | [1-(5-bromo-3-chloro-2-pyridinyl)azetidin-3-yl]methanamine |
|---|---|
| PubChem CID | 103584239 |
| Molecular Formula | C9H11BrClN3 |
| Molecular Weight | 276.56 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | [1-(5-bromo-3-chloro-2-pyridinyl)azetidin-3-yl]methanamine |
| SMILES | NCC1CN(c2ncc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C9H11BrClN3/c10-7-1-8(11)9(13-3-7)14-4-6(2-12)5-14/h1,3,6H,2,4-5,12H2 |
| InChIKey | KUMNDFOZFRBNCZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.56 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |