C11H13Br2ClN2O — CID 103584210
4-(5-bromo-3-chloro-2-pyridinyl)-2-(bromomethyl)-6-methylmorpholine (PubChem CID 103584210) has the molecular formula C11H13Br2ClN2O and a molecular weight of 384.50 g/mol. Its IUPAC name is 4-(5-bromo-3-chloro-2-pyridinyl)-2-(bromomethyl)-6-methylmorpholine.
| Compound Name | 4-(5-bromo-3-chloro-2-pyridinyl)-2-(bromomethyl)-6-methylmorpholine |
|---|---|
| PubChem CID | 103584210 |
| Molecular Formula | C11H13Br2ClN2O |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 381.91 |
| IUPAC Name | 4-(5-bromo-3-chloro-2-pyridinyl)-2-(bromomethyl)-6-methylmorpholine |
| SMILES | CC1CN(c2ncc(Br)cc2Cl)CC(CBr)O1 |
| InChI | InChI=1S/C11H13Br2ClN2O/c1-7-5-16(6-9(3-12)17-7)11-10(14)2-8(13)4-15-11/h2,4,7,9H,3,5-6H2,1H3 |
| InChIKey | LESDFROXWKHSDS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|