C12H16Br2N2O — CID 102937171
2-(bromomethyl)-4-(3-bromo-5-methyl-2-pyridinyl)-6-methylmorpholine (PubChem CID 102937171) has the molecular formula C12H16Br2N2O and a molecular weight of 364.08 g/mol. Its IUPAC name is 2-(bromomethyl)-4-(3-bromo-5-methyl-2-pyridinyl)-6-methylmorpholine.
| Compound Name | 2-(bromomethyl)-4-(3-bromo-5-methyl-2-pyridinyl)-6-methylmorpholine |
|---|---|
| PubChem CID | 102937171 |
| Molecular Formula | C12H16Br2N2O |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | 2-(bromomethyl)-4-(3-bromo-5-methyl-2-pyridinyl)-6-methylmorpholine |
| SMILES | Cc1cnc(N2CC(C)OC(CBr)C2)c(Br)c1 |
| InChI | InChI=1S/C12H16Br2N2O/c1-8-3-11(14)12(15-5-8)16-6-9(2)17-10(4-13)7-16/h3,5,9-10H,4,6-7H2,1-2H3 |
| InChIKey | MENCJUBYJBXLSM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|