C17H20FN3OS — CID 134454712
(3aR,6aS)-5-(4-fluorophenoxy)-2-(1H-pyrazol-4-ylsulfanylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 134454712) has the molecular formula C17H20FN3OS and a molecular weight of 333.43 g/mol. Its IUPAC name is (3aR,6aS)-5-(4-fluorophenoxy)-2-(1H-pyrazol-4-ylsulfanylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aR,6aS)-5-(4-fluorophenoxy)-2-(1H-pyrazol-4-ylsulfanylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 134454712 |
| Molecular Formula | C17H20FN3OS |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (3aR,6aS)-5-(4-fluorophenoxy)-2-(1H-pyrazol-4-ylsulfanylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Fc1ccc(OC2C[C@@H]3CN(CSc4cn[nH]c4)C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C17H20FN3OS/c18-14-1-3-15(4-2-14)22-16-5-12-9-21(10-13(12)6-16)11-23-17-7-19-20-8-17/h1-4,7-8,12-13,16H,5-6,9-11H2,(H,19,20)/t12-,13+,16? |
| InChIKey | ZTTKPQDDBIBKRN-OCZCAGDBSA-N |
| XLogP | 3.39 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |