C20H22FIN2O3 — CID 121247631
[4-[2-[(3aR,6aS)-5-[(2-fluoro-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenyl] hypoiodite (PubChem CID 121247631) has the molecular formula C20H22FIN2O3 and a molecular weight of 484.31 g/mol. Its IUPAC name is [4-[2-[(3aR,6aS)-5-[(2-fluoro-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenyl] hypoiodite.
| Compound Name | [4-[2-[(3aR,6aS)-5-[(2-fluoro-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenyl] hypoiodite |
|---|---|
| PubChem CID | 121247631 |
| Molecular Formula | C20H22FIN2O3 |
| Molecular Weight | 484.31 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | [4-[2-[(3aR,6aS)-5-[(2-fluoro-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenyl] hypoiodite |
| SMILES | OC(CN1C[C@H]2CC(Oc3cccnc3F)C[C@H]2C1)c1ccc(OI)cc1 |
| InChI | InChI=1S/C20H22FIN2O3/c21-20-19(2-1-7-23-20)26-17-8-14-10-24(11-15(14)9-17)12-18(25)13-3-5-16(27-22)6-4-13/h1-7,14-15,17-18,25H,8-12H2/t14-,15+,17?,18? |
| InChIKey | PGJJJDSLPDVLAT-BXXOZEPKSA-N |
| XLogP | 3.77 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|