C21H28FN3O2 — CID 172667313
(3aR,5R,6R,7aS)-2-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-6-(4-fluorophenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172667313) has the molecular formula C21H28FN3O2 and a molecular weight of 373.47 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-6-(4-fluorophenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-6-(4-fluorophenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172667313 |
| Molecular Formula | C21H28FN3O2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]-6-(4-fluorophenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CCc1nc(CN2C[C@H]3C[C@@H](Oc4ccc(F)cc4)[C@H](O)C[C@H]3C2)c(C)[nH]1 |
| InChI | InChI=1S/C21H28FN3O2/c1-3-21-23-13(2)18(24-21)12-25-10-14-8-19(26)20(9-15(14)11-25)27-17-6-4-16(22)5-7-17/h4-7,14-15,19-20,26H,3,8-12H2,1-2H3,(H,23,24)/t14-,15+,19+,20+/m0/s1 |
| InChIKey | PXWAYPICYAJYRE-KQEPKPNTSA-N |
| XLogP | 3.07 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |