C19H26FNO4 — CID 172668504
1-[(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-hydroxy-2,2-dimethylpropan-1-one (PubChem CID 172668504) has the molecular formula C19H26FNO4 and a molecular weight of 351.42 g/mol. Its IUPAC name is 1-[(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-hydroxy-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-hydroxy-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 172668504 |
| Molecular Formula | C19H26FNO4 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-[(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-hydroxy-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(CO)C(=O)N1C[C@H]2C[C@@H](Oc3ccc(F)cc3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C19H26FNO4/c1-19(2,11-22)18(24)21-9-12-7-16(23)17(8-13(12)10-21)25-15-5-3-14(20)4-6-15/h3-6,12-13,16-17,22-23H,7-11H2,1-2H3/t12-,13+,16+,17+/m0/s1 |
| InChIKey | RQTISBMABFHRGW-NSNWQYSKSA-N |
| XLogP | 1.82 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |