C20H20FN5O3 — CID 172660583
[(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(tetrazolo[1,5-a]pyridin-6-yl)methanone (PubChem CID 172660583) has the molecular formula C20H20FN5O3 and a molecular weight of 397.41 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(tetrazolo[1,5-a]pyridin-6-yl)methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(tetrazolo[1,5-a]pyridin-6-yl)methanone |
|---|---|
| PubChem CID | 172660583 |
| Molecular Formula | C20H20FN5O3 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(tetrazolo[1,5-a]pyridin-6-yl)methanone |
| SMILES | O=C(c1ccc2nnnn2c1)N1C[C@H]2C[C@@H](Oc3ccc(F)cc3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C20H20FN5O3/c21-15-2-4-16(5-3-15)29-18-8-14-10-25(9-13(14)7-17(18)27)20(28)12-1-6-19-22-23-24-26(19)11-12/h1-6,11,13-14,17-18,27H,7-10H2/t13-,14+,17+,18+/m0/s1 |
| InChIKey | YXQLJPMXZUOJAJ-MJSCVDMRSA-N |
| XLogP | 1.55 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |