C19H26N2O5 — CID 172661599
1-[(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-amino-2-methylpropan-1-one (PubChem CID 172661599) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-[(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-amino-2-methylpropan-1-one.
| Compound Name | 1-[(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-amino-2-methylpropan-1-one |
|---|---|
| PubChem CID | 172661599 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-[(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-amino-2-methylpropan-1-one |
| SMILES | CC(C)(N)C(=O)N1C[C@H]2C[C@@H](Oc3ccc4c(c3)OCO4)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C19H26N2O5/c1-19(2,20)18(23)21-8-11-5-14(22)16(6-12(11)9-21)26-13-3-4-15-17(7-13)25-10-24-15/h3-4,7,11-12,14,16,22H,5-6,8-10,20H2,1-2H3/t11-,12+,14+,16+/m0/s1 |
| InChIKey | UEUDDYJVLSJAHR-KLZCAUPSSA-N |
| XLogP | 1.13 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |