C21H25N3O4 — CID 172659022
(3aR,5R,6R,7aS)-2-[(2-amino-3-pyridinyl)methyl]-6-(1,3-benzodioxol-5-yloxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172659022) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(2-amino-3-pyridinyl)methyl]-6-(1,3-benzodioxol-5-yloxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[(2-amino-3-pyridinyl)methyl]-6-(1,3-benzodioxol-5-yloxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172659022 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(2-amino-3-pyridinyl)methyl]-6-(1,3-benzodioxol-5-yloxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | Nc1ncccc1CN1C[C@H]2C[C@@H](Oc3ccc4c(c3)OCO4)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C21H25N3O4/c22-21-13(2-1-5-23-21)9-24-10-14-6-17(25)19(7-15(14)11-24)28-16-3-4-18-20(8-16)27-12-26-18/h1-5,8,14-15,17,19,25H,6-7,9-12H2,(H2,22,23)/t14-,15+,17+,19+/m0/s1 |
| InChIKey | MAVYQBJJBIOUDA-BUIAKZPTSA-N |
| XLogP | 2.04 |
| TPSA | 90.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |