C24H26N2O4 — CID 172661848
(3aR,5R,6R,7aS)-6-(1,3-benzodioxol-5-yloxy)-2-(1H-indol-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172661848) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-6-(1,3-benzodioxol-5-yloxy)-2-(1H-indol-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-6-(1,3-benzodioxol-5-yloxy)-2-(1H-indol-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172661848 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (3aR,5R,6R,7aS)-6-(1,3-benzodioxol-5-yloxy)-2-(1H-indol-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | O[C@@H]1C[C@H]2CN(Cc3cc4ccccc4[nH]3)C[C@H]2C[C@H]1Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H26N2O4/c27-21-8-16-11-26(13-18-7-15-3-1-2-4-20(15)25-18)12-17(16)9-23(21)30-19-5-6-22-24(10-19)29-14-28-22/h1-7,10,16-17,21,23,25,27H,8-9,11-14H2/t16-,17+,21+,23+/m0/s1 |
| InChIKey | WUYVPZREXRDDMX-HFTZPDGKSA-N |
| XLogP | 3.55 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |