C23H25NO6 — CID 172670704
(3aR,5R,6R,7aS)-2-(1,3-benzodioxol-4-ylmethyl)-6-(1,3-benzodioxol-5-yloxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172670704) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-(1,3-benzodioxol-4-ylmethyl)-6-(1,3-benzodioxol-5-yloxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-(1,3-benzodioxol-4-ylmethyl)-6-(1,3-benzodioxol-5-yloxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172670704 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-(1,3-benzodioxol-4-ylmethyl)-6-(1,3-benzodioxol-5-yloxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | O[C@@H]1C[C@H]2CN(Cc3cccc4c3OCO4)C[C@H]2C[C@H]1Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H25NO6/c25-18-6-15-10-24(9-14-2-1-3-20-23(14)29-13-27-20)11-16(15)7-21(18)30-17-4-5-19-22(8-17)28-12-26-19/h1-5,8,15-16,18,21,25H,6-7,9-13H2/t15-,16+,18+,21+/m0/s1 |
| InChIKey | LBFRLPBGYZGTPU-LTVCHDBBSA-N |
| XLogP | 2.79 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |