C25H29NO5 — CID 172659995
[(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-propan-2-ylphenyl)methanone (PubChem CID 172659995) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-propan-2-ylphenyl)methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-propan-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 172659995 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-propan-2-ylphenyl)methanone |
| SMILES | CC(C)c1ccc(C(=O)N2C[C@H]3C[C@@H](Oc4ccc5c(c4)OCO5)[C@H](O)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C25H29NO5/c1-15(2)16-3-5-17(6-4-16)25(28)26-12-18-9-21(27)23(10-19(18)13-26)31-20-7-8-22-24(11-20)30-14-29-22/h3-8,11,15,18-19,21,23,27H,9-10,12-14H2,1-2H3/t18-,19+,21+,23+/m0/s1 |
| InChIKey | VNBNQBMIGSVARC-KLJZETAQSA-N |
| XLogP | 3.83 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |