C22H24F2N2O5 — CID 172658183
[(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[1-(difluoromethyl)-5-methylpyrrol-2-yl]methanone (PubChem CID 172658183) has the molecular formula C22H24F2N2O5 and a molecular weight of 434.44 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[1-(difluoromethyl)-5-methylpyrrol-2-yl]methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[1-(difluoromethyl)-5-methylpyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 172658183 |
| Molecular Formula | C22H24F2N2O5 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[1-(difluoromethyl)-5-methylpyrrol-2-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2C[C@H]3C[C@@H](Oc4ccc5c(c4)OCO5)[C@H](O)C[C@H]3C2)n1C(F)F |
| InChI | InChI=1S/C22H24F2N2O5/c1-12-2-4-16(26(12)22(23)24)21(28)25-9-13-6-17(27)19(7-14(13)10-25)31-15-3-5-18-20(8-15)30-11-29-18/h2-5,8,13-14,17,19,22,27H,6-7,9-11H2,1H3/t13-,14+,17+,19+/m0/s1 |
| InChIKey | VPGNWSMYBGNUMF-FCZZECIWSA-N |
| XLogP | 3.21 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |