C22H29F2NO4 — CID 172670580
(3aR,5R,6R,7aS)-6-(1,3-benzodioxol-5-yloxy)-2-[(4,4-difluorocyclohexyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172670580) has the molecular formula C22H29F2NO4 and a molecular weight of 409.47 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-6-(1,3-benzodioxol-5-yloxy)-2-[(4,4-difluorocyclohexyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-6-(1,3-benzodioxol-5-yloxy)-2-[(4,4-difluorocyclohexyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172670580 |
| Molecular Formula | C22H29F2NO4 |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (3aR,5R,6R,7aS)-6-(1,3-benzodioxol-5-yloxy)-2-[(4,4-difluorocyclohexyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | O[C@@H]1C[C@H]2CN(CC3CCC(F)(F)CC3)C[C@H]2C[C@H]1Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H29F2NO4/c23-22(24)5-3-14(4-6-22)10-25-11-15-7-18(26)20(8-16(15)12-25)29-17-1-2-19-21(9-17)28-13-27-19/h1-2,9,14-16,18,20,26H,3-8,10-13H2/t15-,16+,18+,20+/m0/s1 |
| InChIKey | SGWMBGJCVCAFAJ-IXIUHKBRSA-N |
| XLogP | 3.69 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |