C20H23N3O4S — CID 172667074
(3aR,5R,6R,7aS)-6-(1,3-benzodioxol-5-yloxy)-2-(2-methylsulfanylpyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172667074) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-6-(1,3-benzodioxol-5-yloxy)-2-(2-methylsulfanylpyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-6-(1,3-benzodioxol-5-yloxy)-2-(2-methylsulfanylpyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172667074 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (3aR,5R,6R,7aS)-6-(1,3-benzodioxol-5-yloxy)-2-(2-methylsulfanylpyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CSc1nccc(N2C[C@H]3C[C@@H](Oc4ccc5c(c4)OCO5)[C@H](O)C[C@H]3C2)n1 |
| InChI | InChI=1S/C20H23N3O4S/c1-28-20-21-5-4-19(22-20)23-9-12-6-15(24)17(7-13(12)10-23)27-14-2-3-16-18(8-14)26-11-25-16/h2-5,8,12-13,15,17,24H,6-7,9-11H2,1H3/t12-,13+,15+,17+/m0/s1 |
| InChIKey | NFNJEUMEUIVXNC-TZDHZFECSA-N |
| XLogP | 2.58 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |