C23H26N2O5 — CID 172656088
[(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,6-dimethyl-3-pyridinyl)methanone (PubChem CID 172656088) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,6-dimethyl-3-pyridinyl)methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,6-dimethyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 172656088 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(1,3-benzodioxol-5-yloxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,6-dimethyl-3-pyridinyl)methanone |
| SMILES | Cc1ccc(C(=O)N2C[C@H]3C[C@@H](Oc4ccc5c(c4)OCO5)[C@H](O)C[C@H]3C2)c(C)n1 |
| InChI | InChI=1S/C23H26N2O5/c1-13-3-5-18(14(2)24-13)23(27)25-10-15-7-19(26)21(8-16(15)11-25)30-17-4-6-20-22(9-17)29-12-28-20/h3-6,9,15-16,19,21,26H,7-8,10-12H2,1-2H3/t15-,16+,19+,21+/m0/s1 |
| InChIKey | IJWSIPWCSMPFFQ-VXIWKAIFSA-N |
| XLogP | 2.72 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |