C28H28FNO3 — CID 118981672
2-[(3aR,6aS)-5-(4-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-phenylmethoxyphenyl)ethanone (PubChem CID 118981672) has the molecular formula C28H28FNO3 and a molecular weight of 445.53 g/mol. Its IUPAC name is 2-[(3aR,6aS)-5-(4-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-phenylmethoxyphenyl)ethanone.
| Compound Name | 2-[(3aR,6aS)-5-(4-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-phenylmethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 118981672 |
| Molecular Formula | C28H28FNO3 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 2-[(3aR,6aS)-5-(4-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-phenylmethoxyphenyl)ethanone |
| SMILES | O=C(CN1C[C@H]2CC(Oc3ccc(F)cc3)C[C@H]2C1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H28FNO3/c29-24-8-12-26(13-9-24)33-27-14-22-16-30(17-23(22)15-27)18-28(31)21-6-10-25(11-7-21)32-19-20-4-2-1-3-5-20/h1-13,22-23,27H,14-19H2/t22-,23+,27? |
| InChIKey | VNZFEHUSZHNWTF-APBVPVKBSA-N |
| XLogP | 5.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |