C30H35NO3 — CID 134450604
(3aS,6aR)-2-[2-methoxy-2-(4-phenylmethoxyphenyl)ethyl]-5-(4-methylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 134450604) has the molecular formula C30H35NO3 and a molecular weight of 457.61 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-methoxy-2-(4-phenylmethoxyphenyl)ethyl]-5-(4-methylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aS,6aR)-2-[2-methoxy-2-(4-phenylmethoxyphenyl)ethyl]-5-(4-methylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 134450604 |
| Molecular Formula | C30H35NO3 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | (3aS,6aR)-2-[2-methoxy-2-(4-phenylmethoxyphenyl)ethyl]-5-(4-methylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | COC(CN1C[C@H]2CC(Oc3ccc(C)cc3)C[C@H]2C1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H35NO3/c1-22-8-12-28(13-9-22)34-29-16-25-18-31(19-26(25)17-29)20-30(32-2)24-10-14-27(15-11-24)33-21-23-6-4-3-5-7-23/h3-15,25-26,29-30H,16-21H2,1-2H3/t25-,26+,29?,30? |
| InChIKey | UKAAPJJIYUINEB-CCSVULQMSA-N |
| XLogP | 6.05 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |