C22H26N2O5 — CID 121247594
2-[(3aS,6aR)-5-(4-methoxyphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(5-hydroxy-6-methoxy-2-pyridinyl)ethanone (PubChem CID 121247594) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-(4-methoxyphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(5-hydroxy-6-methoxy-2-pyridinyl)ethanone.
| Compound Name | 2-[(3aS,6aR)-5-(4-methoxyphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(5-hydroxy-6-methoxy-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 121247594 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-[(3aS,6aR)-5-(4-methoxyphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(5-hydroxy-6-methoxy-2-pyridinyl)ethanone |
| SMILES | COc1ccc(OC2C[C@@H]3CN(CC(=O)c4ccc(O)c(OC)n4)C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-27-16-3-5-17(6-4-16)29-18-9-14-11-24(12-15(14)10-18)13-21(26)19-7-8-20(25)22(23-19)28-2/h3-8,14-15,18,25H,9-13H2,1-2H3/t14-,15+,18? |
| InChIKey | GOPQXCDLNFNAFE-MVVMVCHASA-N |
| XLogP | 2.78 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |