C20H24N2OS — CID 126687343
4-[[(3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methylsulfanyl]phenol (PubChem CID 126687343) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is 4-[[(3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methylsulfanyl]phenol.
| Compound Name | 4-[[(3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methylsulfanyl]phenol |
|---|---|
| PubChem CID | 126687343 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-[[(3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methylsulfanyl]phenol |
| SMILES | Oc1ccc(SCN2C[C@@H]3CN(Cc4ccccc4)C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C20H24N2OS/c23-19-6-8-20(9-7-19)24-15-22-13-17-11-21(12-18(17)14-22)10-16-4-2-1-3-5-16/h1-9,17-18,23H,10-15H2/t17-,18+ |
| InChIKey | GYAJAHCWGICICX-HDICACEKSA-N |
| XLogP | 3.51 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |