C20H23NOS2 — CID 155329722
4-[[(3aR,6aS)-5-phenylsulfanyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methylsulfanyl]phenol (PubChem CID 155329722) has the molecular formula C20H23NOS2 and a molecular weight of 357.54 g/mol. Its IUPAC name is 4-[[(3aR,6aS)-5-phenylsulfanyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methylsulfanyl]phenol.
| Compound Name | 4-[[(3aR,6aS)-5-phenylsulfanyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methylsulfanyl]phenol |
|---|---|
| PubChem CID | 155329722 |
| Molecular Formula | C20H23NOS2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-[[(3aR,6aS)-5-phenylsulfanyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methylsulfanyl]phenol |
| SMILES | Oc1ccc(SCN2C[C@H]3CC(Sc4ccccc4)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C20H23NOS2/c22-17-6-8-18(9-7-17)23-14-21-12-15-10-20(11-16(15)13-21)24-19-4-2-1-3-5-19/h1-9,15-16,20,22H,10-14H2/t15-,16+,20? |
| InChIKey | GSVPVRQZPDAVNC-NYTJIUQPSA-N |
| XLogP | 4.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |