C20H25NO2S — CID 10269002
4-[1-(3-hydroxy-4-phenylbutyl)pyrrolidin-3-yl]sulfanylphenol (PubChem CID 10269002) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is 4-[1-(3-hydroxy-4-phenylbutyl)pyrrolidin-3-yl]sulfanylphenol.
| Compound Name | 4-[1-(3-hydroxy-4-phenylbutyl)pyrrolidin-3-yl]sulfanylphenol |
|---|---|
| PubChem CID | 10269002 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 4-[1-(3-hydroxy-4-phenylbutyl)pyrrolidin-3-yl]sulfanylphenol |
| SMILES | Oc1ccc(SC2CCN(CCC(O)Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H25NO2S/c22-17-6-8-19(9-7-17)24-20-11-13-21(15-20)12-10-18(23)14-16-4-2-1-3-5-16/h1-9,18,20,22-23H,10-15H2 |
| InChIKey | XFXVQMZVLJOTDW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |