C23H31NO2 — CID 56974173
4-[(1S)-4-(4-benzylpiperidin-1-yl)-1-hydroxy-2-methylbutyl]phenol (PubChem CID 56974173) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-[(1S)-4-(4-benzylpiperidin-1-yl)-1-hydroxy-2-methylbutyl]phenol.
| Compound Name | 4-[(1S)-4-(4-benzylpiperidin-1-yl)-1-hydroxy-2-methylbutyl]phenol |
|---|---|
| PubChem CID | 56974173 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 4-[(1S)-4-(4-benzylpiperidin-1-yl)-1-hydroxy-2-methylbutyl]phenol |
| SMILES | CC(CCN1CCC(Cc2ccccc2)CC1)[C@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H31NO2/c1-18(23(26)21-7-9-22(25)10-8-21)11-14-24-15-12-20(13-16-24)17-19-5-3-2-4-6-19/h2-10,18,20,23,25-26H,11-17H2,1H3/t18?,23-/m0/s1 |
| InChIKey | UPKSTPOFKPHFPZ-IMMUGOHXSA-N |
| XLogP | 4.41 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |