C22H29NO2 — CID 90803091
4-[(1S)-1-(4-benzylpiperidin-1-yl)-1-hydroxy-2-methylpropyl]phenol (PubChem CID 90803091) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-[(1S)-1-(4-benzylpiperidin-1-yl)-1-hydroxy-2-methylpropyl]phenol.
| Compound Name | 4-[(1S)-1-(4-benzylpiperidin-1-yl)-1-hydroxy-2-methylpropyl]phenol |
|---|---|
| PubChem CID | 90803091 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 4-[(1S)-1-(4-benzylpiperidin-1-yl)-1-hydroxy-2-methylpropyl]phenol |
| SMILES | CC(C)[C@](O)(c1ccc(O)cc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29NO2/c1-17(2)22(25,20-8-10-21(24)11-9-20)23-14-12-19(13-15-23)16-18-6-4-3-5-7-18/h3-11,17,19,24-25H,12-16H2,1-2H3/t22-/m0/s1 |
| InChIKey | BSWNNBHDIRLTDX-QFIPXVFZSA-N |
| XLogP | 4.15 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |