C20H24FNOS — CID 10291255
4-[(3S)-1-(2-fluoro-4-phenylbutyl)pyrrolidin-3-yl]sulfanylphenol (PubChem CID 10291255) has the molecular formula C20H24FNOS and a molecular weight of 345.48 g/mol. Its IUPAC name is 4-[(3S)-1-(2-fluoro-4-phenylbutyl)pyrrolidin-3-yl]sulfanylphenol.
| Compound Name | 4-[(3S)-1-(2-fluoro-4-phenylbutyl)pyrrolidin-3-yl]sulfanylphenol |
|---|---|
| PubChem CID | 10291255 |
| Molecular Formula | C20H24FNOS |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 4-[(3S)-1-(2-fluoro-4-phenylbutyl)pyrrolidin-3-yl]sulfanylphenol |
| SMILES | Oc1ccc(S[C@H]2CCN(CC(F)CCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H24FNOS/c21-17(7-6-16-4-2-1-3-5-16)14-22-13-12-20(15-22)24-19-10-8-18(23)9-11-19/h1-5,8-11,17,20,23H,6-7,12-15H2/t17?,20-/m0/s1 |
| InChIKey | QWRNWSJHVMHKRN-OZBJMMHXSA-N |
| XLogP | 4.53 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |