C12H17NO2S — CID 106672594
1-(2-phenylsulfanylethyl)pyrrolidine-3,4-diol (PubChem CID 106672594) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 1-(2-phenylsulfanylethyl)pyrrolidine-3,4-diol.
| Compound Name | 1-(2-phenylsulfanylethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106672594 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 1-(2-phenylsulfanylethyl)pyrrolidine-3,4-diol |
| SMILES | OC1CN(CCSc2ccccc2)CC1O |
| InChI | InChI=1S/C12H17NO2S/c14-11-8-13(9-12(11)15)6-7-16-10-4-2-1-3-5-10/h1-5,11-12,14-15H,6-9H2 |
| InChIKey | NQAZIYMOFOBAIC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |