C12H16FNO2S — CID 79420540
(3R,4S)-1-[2-(2-fluorophenyl)sulfanylethyl]pyrrolidine-3,4-diol (PubChem CID 79420540) has the molecular formula C12H16FNO2S and a molecular weight of 257.33 g/mol. Its IUPAC name is (3R,4S)-1-[2-(2-fluorophenyl)sulfanylethyl]pyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-[2-(2-fluorophenyl)sulfanylethyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79420540 |
| Molecular Formula | C12H16FNO2S |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (3R,4S)-1-[2-(2-fluorophenyl)sulfanylethyl]pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(CCSc2ccccc2F)C[C@@H]1O |
| InChI | InChI=1S/C12H16FNO2S/c13-9-3-1-2-4-12(9)17-6-5-14-7-10(15)11(16)8-14/h1-4,10-11,15-16H,5-8H2/t10-,11+ |
| InChIKey | RFLABGRUTHEYPP-PHIMTYICSA-N |
| XLogP | 0.96 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |