C20H23F2N3OS — CID 8719281
N-(4-fluorophenyl)-2-[4-[2-(2-fluorophenyl)sulfanylethyl]piperazin-1-yl]acetamide (PubChem CID 8719281) has the molecular formula C20H23F2N3OS and a molecular weight of 391.49 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-[2-(2-fluorophenyl)sulfanylethyl]piperazin-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-[2-(2-fluorophenyl)sulfanylethyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8719281 |
| Molecular Formula | C20H23F2N3OS |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-[2-(2-fluorophenyl)sulfanylethyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CCSc2ccccc2F)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H23F2N3OS/c21-16-5-7-17(8-6-16)23-20(26)15-25-11-9-24(10-12-25)13-14-27-19-4-2-1-3-18(19)22/h1-8H,9-15H2,(H,23,26) |
| InChIKey | BWYUHMJRWKGTRX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |