C17H16F2N2O2S — CID 16520353
N-(4-fluorophenyl)-2-[[2-(2-fluorophenyl)sulfanylacetyl]-methylamino]acetamide (PubChem CID 16520353) has the molecular formula C17H16F2N2O2S and a molecular weight of 350.39 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[2-(2-fluorophenyl)sulfanylacetyl]-methylamino]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[[2-(2-fluorophenyl)sulfanylacetyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 16520353 |
| Molecular Formula | C17H16F2N2O2S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[2-(2-fluorophenyl)sulfanylacetyl]-methylamino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(F)cc1)C(=O)CSc1ccccc1F |
| InChI | InChI=1S/C17H16F2N2O2S/c1-21(10-16(22)20-13-8-6-12(18)7-9-13)17(23)11-24-15-5-3-2-4-14(15)19/h2-9H,10-11H2,1H3,(H,20,22) |
| InChIKey | OKBDNQQVFJLNTH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |