C15H21FN2S — CID 102682732
(4aS,7aS)-6-[2-(2-fluorophenyl)sulfanylethyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102682732) has the molecular formula C15H21FN2S and a molecular weight of 280.41 g/mol. Its IUPAC name is (4aS,7aS)-6-[2-(2-fluorophenyl)sulfanylethyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-[2-(2-fluorophenyl)sulfanylethyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102682732 |
| Molecular Formula | C15H21FN2S |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (4aS,7aS)-6-[2-(2-fluorophenyl)sulfanylethyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | Fc1ccccc1SCCN1C[C@@H]2CCCN[C@@H]2C1 |
| InChI | InChI=1S/C15H21FN2S/c16-13-5-1-2-6-15(13)19-9-8-18-10-12-4-3-7-17-14(12)11-18/h1-2,5-6,12,14,17H,3-4,7-11H2/t12-,14+/m0/s1 |
| InChIKey | JVTKGLOJRNXABO-GXTWGEPZSA-N |
| XLogP | 2.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |