C14H22N2S — CID 79315398
1,2-dimethyl-4-(2-phenylsulfanylethyl)piperazine (PubChem CID 79315398) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is 1,2-dimethyl-4-(2-phenylsulfanylethyl)piperazine.
| Compound Name | 1,2-dimethyl-4-(2-phenylsulfanylethyl)piperazine |
|---|---|
| PubChem CID | 79315398 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1,2-dimethyl-4-(2-phenylsulfanylethyl)piperazine |
| SMILES | CC1CN(CCSc2ccccc2)CCN1C |
| InChI | InChI=1S/C14H22N2S/c1-13-12-16(9-8-15(13)2)10-11-17-14-6-4-3-5-7-14/h3-7,13H,8-12H2,1-2H3 |
| InChIKey | AYKJPJWPGZGBLN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |