C27H32FN3 — CID 134454529
(3aR,6aS)-2-[2-(1-benzylpyrazol-4-yl)propyl]-5-[(4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 134454529) has the molecular formula C27H32FN3 and a molecular weight of 417.57 g/mol. Its IUPAC name is (3aR,6aS)-2-[2-(1-benzylpyrazol-4-yl)propyl]-5-[(4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aR,6aS)-2-[2-(1-benzylpyrazol-4-yl)propyl]-5-[(4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 134454529 |
| Molecular Formula | C27H32FN3 |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | (3aR,6aS)-2-[2-(1-benzylpyrazol-4-yl)propyl]-5-[(4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | CC(CN1C[C@H]2CC(Cc3ccc(F)cc3)C[C@H]2C1)c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C27H32FN3/c1-20(26-14-29-31(19-26)16-22-5-3-2-4-6-22)15-30-17-24-12-23(13-25(24)18-30)11-21-7-9-27(28)10-8-21/h2-10,14,19-20,23-25H,11-13,15-18H2,1H3/t20?,23?,24-,25+ |
| InChIKey | XIDSDIOTXBWLHP-PNTKIAGGSA-N |
| XLogP | 5.37 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |