About 1-(aminomethyl)piperidine-3,4,5-triol
1-(aminomethyl)piperidine-3,4,5-triol (PubChem CID 67340037) has the molecular formula C6H14N2O3
and a molecular weight of 162.19 g/mol. Its IUPAC name is 1-(aminomethyl)piperidine-3,4,5-triol.
Molecular Properties
| Compound Name | 1-(aminomethyl)piperidine-3,4,5-triol |
| PubChem CID | 67340037 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 1-(aminomethyl)piperidine-3,4,5-triol |
| SMILES | NCN1CC(O)C(O)C(O)C1 |
| InChI | InChI=1S/C6H14N2O3/c7-3-8-1-4(9)6(11)5(10)2-8/h4-6,9-11H,1-3,7H2 |
| InChIKey | MIGKFHLGAQJEEB-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(aminomethyl)piperidine-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminomethyl)piperidine-3,4,5-triol?
The IUPAC name of 1-(aminomethyl)piperidine-3,4,5-triol (CID 67340037) is 1-(aminomethyl)piperidine-3,4,5-triol.
What is the SMILES notation for 1-(aminomethyl)piperidine-3,4,5-triol?
The canonical SMILES for 1-(aminomethyl)piperidine-3,4,5-triol is NCN1CC(O)C(O)C(O)C1.
What is the InChIKey of 1-(aminomethyl)piperidine-3,4,5-triol?
The InChIKey is MIGKFHLGAQJEEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O3/c7-3-8-1-4(9)6(11)5(10)2-8/h4-6,9-11H,1-3,7H2.
What are the key properties of 1-(aminomethyl)piperidine-3,4,5-triol?
1-(aminomethyl)piperidine-3,4,5-triol has a molecular weight of 162.19 g/mol, XLogP of -2.70, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminomethyl)piperidine-3,4,5-triol is sourced from PubChem (CID 67340037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).