C6H14N2O3 — CID 67340037
1-(aminomethyl)piperidine-3,4,5-triol (PubChem CID 67340037) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is 1-(aminomethyl)piperidine-3,4,5-triol.
| Compound Name | 1-(aminomethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 67340037 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 1-(aminomethyl)piperidine-3,4,5-triol |
| SMILES | NCN1CC(O)C(O)C(O)C1 |
| InChI | InChI=1S/C6H14N2O3/c7-3-8-1-4(9)6(11)5(10)2-8/h4-6,9-11H,1-3,7H2 |
| InChIKey | MIGKFHLGAQJEEB-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |