C12H21Cl2NO3 — CID 166834243
(3R,5S)-1-[(4,4-dichlorocyclohexyl)methyl]piperidine-3,4,5-triol (PubChem CID 166834243) has the molecular formula C12H21Cl2NO3 and a molecular weight of 298.21 g/mol. Its IUPAC name is (3R,5S)-1-[(4,4-dichlorocyclohexyl)methyl]piperidine-3,4,5-triol.
| Compound Name | (3R,5S)-1-[(4,4-dichlorocyclohexyl)methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 166834243 |
| Molecular Formula | C12H21Cl2NO3 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | (3R,5S)-1-[(4,4-dichlorocyclohexyl)methyl]piperidine-3,4,5-triol |
| SMILES | OC1[C@H](O)CN(CC2CCC(Cl)(Cl)CC2)C[C@@H]1O |
| InChI | InChI=1S/C12H21Cl2NO3/c13-12(14)3-1-8(2-4-12)5-15-6-9(16)11(18)10(17)7-15/h8-11,16-18H,1-7H2/t9-,10+,11? |
| InChIKey | YWZKFARNBCADAE-ZACCUICWSA-N |
| XLogP | 0.75 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|